C14H14FN5O3 — CID 71229156
[(2S,4S,5S)-5-[4-amino-5-(1,3-oxazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-fluorooxolan-2-yl]methanol (PubChem CID 71229156) has the molecular formula C14H14FN5O3 and a molecular weight of 319.30 g/mol. Its IUPAC name is [(2S,4S,5S)-5-[4-amino-5-(1,3-oxazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-fluorooxolan-2-yl]methanol.
| Compound Name | [(2S,4S,5S)-5-[4-amino-5-(1,3-oxazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-fluorooxolan-2-yl]methanol |
|---|---|
| PubChem CID | 71229156 |
| Molecular Formula | C14H14FN5O3 |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | [(2S,4S,5S)-5-[4-amino-5-(1,3-oxazol-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-fluorooxolan-2-yl]methanol |
| SMILES | Nc1ncnn2c([C@@H]3O[C@H](CO)C[C@@H]3F)cc(-c3ncco3)c12 |
| InChI | InChI=1S/C14H14FN5O3/c15-9-3-7(5-21)23-12(9)10-4-8(14-17-1-2-22-14)11-13(16)18-6-19-20(10)11/h1-2,4,6-7,9,12,21H,3,5H2,(H2,16,18,19)/t7-,9-,12+/m0/s1 |
| InChIKey | YKRLZVHHHVBQDA-QOSJWCAFSA-N |
| XLogP | 1.13 |
| TPSA | 111.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |