C25H35FN4O3Si — CID 71229459
N-[7-[1-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-fluorobutoxy]ethyl]pyrrolo[2,3-d]pyrimidin-4-yl]benzamide (PubChem CID 71229459) has the molecular formula C25H35FN4O3Si and a molecular weight of 486.66 g/mol. Its IUPAC name is N-[7-[1-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-fluorobutoxy]ethyl]pyrrolo[2,3-d]pyrimidin-4-yl]benzamide.
| Compound Name | N-[7-[1-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-fluorobutoxy]ethyl]pyrrolo[2,3-d]pyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 71229459 |
| Molecular Formula | C25H35FN4O3Si |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | N-[7-[1-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-fluorobutoxy]ethyl]pyrrolo[2,3-d]pyrimidin-4-yl]benzamide |
| SMILES | CC(F)[C@@H](COC(C)n1ccc2c(NC(=O)c3ccccc3)ncnc21)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H35FN4O3Si/c1-17(26)21(33-34(6,7)25(3,4)5)15-32-18(2)30-14-13-20-22(27-16-28-23(20)30)29-24(31)19-11-9-8-10-12-19/h8-14,16-18,21H,15H2,1-7H3,(H,27,28,29,31)/t17?,18?,21-/m1/s1 |
| InChIKey | NDASJRRCIXJWHX-WIXQSORDSA-N |
| XLogP | 5.97 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|