C22H14BrClN4O3S — CID 71229743
2-bromo-N-[(11-chloro-5-methyl-6,8-dioxoquinolino[1,2-a]quinoxalin-7-yl)methyl]-1,3-thiazole-5-carboxamide (PubChem CID 71229743) has the molecular formula C22H14BrClN4O3S and a molecular weight of 529.80 g/mol. Its IUPAC name is 2-bromo-N-[(11-chloro-5-methyl-6,8-dioxoquinolino[1,2-a]quinoxalin-7-yl)methyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-bromo-N-[(11-chloro-5-methyl-6,8-dioxoquinolino[1,2-a]quinoxalin-7-yl)methyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 71229743 |
| Molecular Formula | C22H14BrClN4O3S |
| Molecular Weight | 529.80 g/mol |
| Exact Mass | 527.97 |
| IUPAC Name | 2-bromo-N-[(11-chloro-5-methyl-6,8-dioxoquinolino[1,2-a]quinoxalin-7-yl)methyl]-1,3-thiazole-5-carboxamide |
| SMILES | Cn1c(=O)c2c(CNC(=O)c3cnc(Br)s3)c(=O)c3ccc(Cl)cc3n2c2ccccc21 |
| InChI | InChI=1S/C22H14BrClN4O3S/c1-27-14-4-2-3-5-15(14)28-16-8-11(24)6-7-12(16)19(29)13(18(28)21(27)31)9-25-20(30)17-10-26-22(23)32-17/h2-8,10H,9H2,1H3,(H,25,30) |
| InChIKey | BOQXSVMVZQCMLW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.80 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|