C13H26N6 — CID 71230303
(4R)-9-[3-(tert-butylamino)propyl]-8-methyl-1,4,5,6-tetrahydropurin-6-amine (PubChem CID 71230303) has the molecular formula C13H26N6 and a molecular weight of 266.39 g/mol. Its IUPAC name is (4R)-9-[3-(tert-butylamino)propyl]-8-methyl-1,4,5,6-tetrahydropurin-6-amine.
| Compound Name | (4R)-9-[3-(tert-butylamino)propyl]-8-methyl-1,4,5,6-tetrahydropurin-6-amine |
|---|---|
| PubChem CID | 71230303 |
| Molecular Formula | C13H26N6 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | (4R)-9-[3-(tert-butylamino)propyl]-8-methyl-1,4,5,6-tetrahydropurin-6-amine |
| SMILES | CC1=NC2C(N)NC=N[C@@H]2N1CCCNC(C)(C)C |
| InChI | InChI=1S/C13H26N6/c1-9-18-10-11(14)15-8-16-12(10)19(9)7-5-6-17-13(2,3)4/h8,10-12,17H,5-7,14H2,1-4H3,(H,15,16)/t10?,11?,12-/m1/s1 |
| InChIKey | BFFQSFMZVRVLEV-HTAVTVPLSA-N |
| XLogP | 0.11 |
| TPSA | 78.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|