C30H41N3O9 — CID 71230512
[(4E,6Z,8S,9S,10E,12S,13R,14S)-19-amino-9-carbamoyloxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-13-yl] acetate (PubChem CID 71230512) has the molecular formula C30H41N3O9 and a molecular weight of 587.67 g/mol. Its IUPAC name is [(4E,6Z,8S,9S,10E,12S,13R,14S)-19-amino-9-carbamoyloxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-13-yl] acetate.
| Compound Name | [(4E,6Z,8S,9S,10E,12S,13R,14S)-19-amino-9-carbamoyloxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-13-yl] acetate |
|---|---|
| PubChem CID | 71230512 |
| Molecular Formula | C30H41N3O9 |
| Molecular Weight | 587.67 g/mol |
| Exact Mass | 587.28 |
| IUPAC Name | [(4E,6Z,8S,9S,10E,12S,13R,14S)-19-amino-9-carbamoyloxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-13-yl] acetate |
| SMILES | CO[C@H]1/C=C\C=C(/C)C(=O)NC2=CC(=O)C(N)=C(CC(C)C[C@H](OC)[C@H](OC(C)=O)[C@@H](C)/C=C(\C)[C@@H]1OC(N)=O)C2=O |
| InChI | InChI=1S/C30H41N3O9/c1-15-11-20-25(31)22(35)14-21(26(20)36)33-29(37)16(2)9-8-10-23(39-6)27(42-30(32)38)17(3)13-18(4)28(41-19(5)34)24(12-15)40-7/h8-10,13-15,18,23-24,27-28H,11-12,31H2,1-7H3,(H2,32,38)(H,33,37)/b10-8-,16-9+,17-13+/t15?,18-,23-,24-,27-,28+/m0/s1 |
| InChIKey | DMFWBIZFBGUCNG-RVTPTPNFSA-N |
| XLogP | 2.29 |
| TPSA | 186.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.67 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|