C16H14F3N5O2 — CID 71230988
N-(3-imidazol-1-ylpropyl)-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide (PubChem CID 71230988) has the molecular formula C16H14F3N5O2 and a molecular weight of 365.32 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide |
|---|---|
| PubChem CID | 71230988 |
| Molecular Formula | C16H14F3N5O2 |
| Molecular Weight | 365.32 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide |
| SMILES | O=C(NCCCn1ccnc1)c1ccc(-c2noc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C16H14F3N5O2/c17-16(18,19)15-22-13(23-26-15)11-2-4-12(5-3-11)14(25)21-6-1-8-24-9-7-20-10-24/h2-5,7,9-10H,1,6,8H2,(H,21,25) |
| InChIKey | LKODDWQUWKQCNK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|