C11H17F2NO4 — CID 71232328
ethyl 4-(2,2-difluoropropanoyloxy)piperidine-1-carboxylate (PubChem CID 71232328) has the molecular formula C11H17F2NO4 and a molecular weight of 265.26 g/mol. Its IUPAC name is ethyl 4-(2,2-difluoropropanoyloxy)piperidine-1-carboxylate.
| Compound Name | ethyl 4-(2,2-difluoropropanoyloxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71232328 |
| Molecular Formula | C11H17F2NO4 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | ethyl 4-(2,2-difluoropropanoyloxy)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(OC(=O)C(C)(F)F)CC1 |
| InChI | InChI=1S/C11H17F2NO4/c1-3-17-10(16)14-6-4-8(5-7-14)18-9(15)11(2,12)13/h8H,3-7H2,1-2H3 |
| InChIKey | RTAQNJHGKPVVDZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |