C13H18O3 — CID 7123275
methyl (4aS)-4a-methyl-2-oxo-3,4,5,6,7,8-hexahydronaphthalene-1-carboxylate (PubChem CID 7123275) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is methyl (4aS)-4a-methyl-2-oxo-3,4,5,6,7,8-hexahydronaphthalene-1-carboxylate.
| Compound Name | methyl (4aS)-4a-methyl-2-oxo-3,4,5,6,7,8-hexahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 7123275 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | methyl (4aS)-4a-methyl-2-oxo-3,4,5,6,7,8-hexahydronaphthalene-1-carboxylate |
| SMILES | COC(=O)C1=C2CCCC[C@@]2(C)CCC1=O |
| InChI | InChI=1S/C13H18O3/c1-13-7-4-3-5-9(13)11(12(15)16-2)10(14)6-8-13/h3-8H2,1-2H3/t13-/m0/s1 |
| InChIKey | GTOXZWSKDRODCR-ZDUSSCGKSA-N |
| XLogP | 2.40 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|