About 1,4-dithian-2-yl 2-oxopropanoate
1,4-dithian-2-yl 2-oxopropanoate (PubChem CID 71233098) has the molecular formula C7H10O3S2
and a molecular weight of 206.29 g/mol. Its IUPAC name is 1,4-dithian-2-yl 2-oxopropanoate.
Molecular Properties
| Compound Name | 1,4-dithian-2-yl 2-oxopropanoate |
| PubChem CID | 71233098 |
| Molecular Formula | C7H10O3S2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.01 |
| IUPAC Name | 1,4-dithian-2-yl 2-oxopropanoate |
| SMILES | CC(=O)C(=O)OC1CSCCS1 |
| InChI | InChI=1S/C7H10O3S2/c1-5(8)7(9)10-6-4-11-2-3-12-6/h6H,2-4H2,1H3 |
| InChIKey | JXKQGEXBGVSEAM-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dithian-2-yl 2-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dithian-2-yl 2-oxopropanoate?
The IUPAC name of 1,4-dithian-2-yl 2-oxopropanoate (CID 71233098) is 1,4-dithian-2-yl 2-oxopropanoate.
What is the SMILES notation for 1,4-dithian-2-yl 2-oxopropanoate?
The canonical SMILES for 1,4-dithian-2-yl 2-oxopropanoate is CC(=O)C(=O)OC1CSCCS1.
What is the InChIKey of 1,4-dithian-2-yl 2-oxopropanoate?
The InChIKey is JXKQGEXBGVSEAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3S2/c1-5(8)7(9)10-6-4-11-2-3-12-6/h6H,2-4H2,1H3.
What are the key properties of 1,4-dithian-2-yl 2-oxopropanoate?
1,4-dithian-2-yl 2-oxopropanoate has a molecular weight of 206.29 g/mol, XLogP of 0.92, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dithian-2-yl 2-oxopropanoate is sourced from PubChem (CID 71233098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).