C28H32ClNOSi — CID 71233123
tert-butyl-[[(2S,3S)-5-(2-chlorophenyl)-3-methyl-3,4-dihydro-2H-pyrrol-2-yl]methoxy]-diphenylsilane (PubChem CID 71233123) has the molecular formula C28H32ClNOSi and a molecular weight of 462.11 g/mol. Its IUPAC name is tert-butyl-[[(2S,3S)-5-(2-chlorophenyl)-3-methyl-3,4-dihydro-2H-pyrrol-2-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2S,3S)-5-(2-chlorophenyl)-3-methyl-3,4-dihydro-2H-pyrrol-2-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 71233123 |
| Molecular Formula | C28H32ClNOSi |
| Molecular Weight | 462.11 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | tert-butyl-[[(2S,3S)-5-(2-chlorophenyl)-3-methyl-3,4-dihydro-2H-pyrrol-2-yl]methoxy]-diphenylsilane |
| SMILES | C[C@H]1CC(c2ccccc2Cl)=N[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H32ClNOSi/c1-21-19-26(24-17-11-12-18-25(24)29)30-27(21)20-31-32(28(2,3)4,22-13-7-5-8-14-22)23-15-9-6-10-16-23/h5-18,21,27H,19-20H2,1-4H3/t21-,27+/m0/s1 |
| InChIKey | QMTOBSLEVJQKIE-KDYSTLNUSA-N |
| XLogP | 6.11 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.11 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|