About 2-pyrrol-1-ylphenol
2-pyrrol-1-ylphenol (PubChem CID 712334) has the molecular formula C10H9NO
and a molecular weight of 159.19 g/mol. Its IUPAC name is 2-pyrrol-1-ylphenol.
Molecular Properties
| Compound Name | 2-pyrrol-1-ylphenol |
| PubChem CID | 712334 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | 2-pyrrol-1-ylphenol |
| SMILES | Oc1ccccc1-n1cccc1 |
| InChI | InChI=1S/C10H9NO/c12-10-6-2-1-5-9(10)11-7-3-4-8-11/h1-8,12H |
| InChIKey | NZABOAAWARHJSH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-pyrrol-1-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrrol-1-ylphenol?
The IUPAC name of 2-pyrrol-1-ylphenol (CID 712334) is 2-pyrrol-1-ylphenol.
What is the SMILES notation for 2-pyrrol-1-ylphenol?
The canonical SMILES for 2-pyrrol-1-ylphenol is Oc1ccccc1-n1cccc1.
What is the InChIKey of 2-pyrrol-1-ylphenol?
The InChIKey is NZABOAAWARHJSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO/c12-10-6-2-1-5-9(10)11-7-3-4-8-11/h1-8,12H.
What are the key properties of 2-pyrrol-1-ylphenol?
2-pyrrol-1-ylphenol has a molecular weight of 159.19 g/mol, XLogP of 2.18, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrrol-1-ylphenol is sourced from PubChem (CID 712334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).