C32H38F3N5 — CID 71233450
trans-(1R,2R)-2-N-[4-(1,2,3,4-tetrahydroisoquinolin-7-yl)-2-pyridinyl]-1-N-[(3S)-1-[4-(trifluoromethyl)phenyl]piperidin-3-yl]cyclohexane-1,2-diamine (PubChem CID 71233450) has the molecular formula C32H38F3N5 and a molecular weight of 549.69 g/mol. Its IUPAC name is trans-(1R,2R)-2-N-[4-(1,2,3,4-tetrahydroisoquinolin-7-yl)-2-pyridinyl]-1-N-[(3S)-1-[4-(trifluoromethyl)phenyl]piperidin-3-yl]cyclohexane-1,2-diamine.
| Compound Name | trans-(1R,2R)-2-N-[4-(1,2,3,4-tetrahydroisoquinolin-7-yl)-2-pyridinyl]-1-N-[(3S)-1-[4-(trifluoromethyl)phenyl]piperidin-3-yl]cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 71233450 |
| Molecular Formula | C32H38F3N5 |
| Molecular Weight | 549.69 g/mol |
| Exact Mass | 549.31 |
| IUPAC Name | trans-(1R,2R)-2-N-[4-(1,2,3,4-tetrahydroisoquinolin-7-yl)-2-pyridinyl]-1-N-[(3S)-1-[4-(trifluoromethyl)phenyl]piperidin-3-yl]cyclohexane-1,2-diamine |
| SMILES | FC(F)(F)c1ccc(N2CCC[C@H](N[C@@H]3CCCC[C@H]3Nc3cc(-c4ccc5c(c4)CNCC5)ccn3)C2)cc1 |
| InChI | InChI=1S/C32H38F3N5/c33-32(34,35)26-9-11-28(12-10-26)40-17-3-4-27(21-40)38-29-5-1-2-6-30(29)39-31-19-24(14-16-37-31)23-8-7-22-13-15-36-20-25(22)18-23/h7-12,14,16,18-19,27,29-30,36,38H,1-6,13,15,17,20-21H2,(H,37,39)/t27-,29+,30+/m0/s1 |
| InChIKey | GYUOKMQHSYQDAE-GNSPLJBXSA-N |
| XLogP | 6.39 |
| TPSA | 52.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.69 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |