C26H26ClF2N3O2 — CID 71233522
1-(4-chloro-1-oxidopyridin-1-ium-2-yl)-1'-[1-[5-(1,1-difluoroethyl)-2-pyridinyl]ethyl]spiro[1H-2-benzofuran-3,4'-piperidine] (PubChem CID 71233522) has the molecular formula C26H26ClF2N3O2 and a molecular weight of 485.96 g/mol. Its IUPAC name is 1-(4-chloro-1-oxidopyridin-1-ium-2-yl)-1'-[1-[5-(1,1-difluoroethyl)-2-pyridinyl]ethyl]spiro[1H-2-benzofuran-3,4'-piperidine].
| Compound Name | 1-(4-chloro-1-oxidopyridin-1-ium-2-yl)-1'-[1-[5-(1,1-difluoroethyl)-2-pyridinyl]ethyl]spiro[1H-2-benzofuran-3,4'-piperidine] |
|---|---|
| PubChem CID | 71233522 |
| Molecular Formula | C26H26ClF2N3O2 |
| Molecular Weight | 485.96 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | 1-(4-chloro-1-oxidopyridin-1-ium-2-yl)-1'-[1-[5-(1,1-difluoroethyl)-2-pyridinyl]ethyl]spiro[1H-2-benzofuran-3,4'-piperidine] |
| SMILES | CC(c1ccc(C(C)(F)F)cn1)N1CCC2(CC1)OC(c1cc(Cl)cc[n+]1[O-])c1ccccc12 |
| InChI | InChI=1S/C26H26ClF2N3O2/c1-17(22-8-7-18(16-30-22)25(2,28)29)31-13-10-26(11-14-31)21-6-4-3-5-20(21)24(34-26)23-15-19(27)9-12-32(23)33/h3-9,12,15-17,24H,10-11,13-14H2,1-2H3 |
| InChIKey | XFYPAIPYOZLPCT-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.96 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|