C33H36N6O3 — CID 71234104
2-cyclopropyl-N-[2-[4-(2-methylphenyl)piperazin-1-yl]-5-(3-pyridin-4-ylpropylcarbamoyl)phenyl]-1,3-oxazole-4-carboxamide (PubChem CID 71234104) has the molecular formula C33H36N6O3 and a molecular weight of 564.69 g/mol. Its IUPAC name is 2-cyclopropyl-N-[2-[4-(2-methylphenyl)piperazin-1-yl]-5-(3-pyridin-4-ylpropylcarbamoyl)phenyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-cyclopropyl-N-[2-[4-(2-methylphenyl)piperazin-1-yl]-5-(3-pyridin-4-ylpropylcarbamoyl)phenyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 71234104 |
| Molecular Formula | C33H36N6O3 |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.28 |
| IUPAC Name | 2-cyclopropyl-N-[2-[4-(2-methylphenyl)piperazin-1-yl]-5-(3-pyridin-4-ylpropylcarbamoyl)phenyl]-1,3-oxazole-4-carboxamide |
| SMILES | Cc1ccccc1N1CCN(c2ccc(C(=O)NCCCc3ccncc3)cc2NC(=O)c2coc(C3CC3)n2)CC1 |
| InChI | InChI=1S/C33H36N6O3/c1-23-5-2-3-7-29(23)38-17-19-39(20-18-38)30-11-10-26(31(40)35-14-4-6-24-12-15-34-16-13-24)21-27(30)36-32(41)28-22-42-33(37-28)25-8-9-25/h2-3,5,7,10-13,15-16,21-22,25H,4,6,8-9,14,17-20H2,1H3,(H,35,40)(H,36,41) |
| InChIKey | HAIXILRCGSWPAO-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|