C17H28O2 — CID 71234769
4-[4-(hydroxymethyl)-2,2,5,5-tetramethylhexan-3-yl]phenol (PubChem CID 71234769) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is 4-[4-(hydroxymethyl)-2,2,5,5-tetramethylhexan-3-yl]phenol.
| Compound Name | 4-[4-(hydroxymethyl)-2,2,5,5-tetramethylhexan-3-yl]phenol |
|---|---|
| PubChem CID | 71234769 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 4-[4-(hydroxymethyl)-2,2,5,5-tetramethylhexan-3-yl]phenol |
| SMILES | CC(C)(C)C(CO)C(c1ccc(O)cc1)C(C)(C)C |
| InChI | InChI=1S/C17H28O2/c1-16(2,3)14(11-18)15(17(4,5)6)12-7-9-13(19)10-8-12/h7-10,14-15,18-19H,11H2,1-6H3 |
| InChIKey | WNZWGBMETFHCLF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |