C16H25N — CID 71234789
6,6,8,9a-tetramethyl-2,3,4,4a,5,9-hexahydro-1H-carbazole (PubChem CID 71234789) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is 6,6,8,9a-tetramethyl-2,3,4,4a,5,9-hexahydro-1H-carbazole.
| Compound Name | 6,6,8,9a-tetramethyl-2,3,4,4a,5,9-hexahydro-1H-carbazole |
|---|---|
| PubChem CID | 71234789 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | 6,6,8,9a-tetramethyl-2,3,4,4a,5,9-hexahydro-1H-carbazole |
| SMILES | CC1=CC(C)(C)CC2=C1NC1(C)CCCCC21 |
| InChI | InChI=1S/C16H25N/c1-11-9-15(2,3)10-12-13-7-5-6-8-16(13,4)17-14(11)12/h9,13,17H,5-8,10H2,1-4H3 |
| InChIKey | QHHBLSCAHWOHME-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |