C20H25NS — CID 71234797
4,9-dimethyl-4,4a,5,6,7,7b,8,9,11a,12c-decahydro-3H-[1]benzothiolo[3,2-c]carbazole (PubChem CID 71234797) has the molecular formula C20H25NS and a molecular weight of 311.49 g/mol. Its IUPAC name is 4,9-dimethyl-4,4a,5,6,7,7b,8,9,11a,12c-decahydro-3H-[1]benzothiolo[3,2-c]carbazole.
| Compound Name | 4,9-dimethyl-4,4a,5,6,7,7b,8,9,11a,12c-decahydro-3H-[1]benzothiolo[3,2-c]carbazole |
|---|---|
| PubChem CID | 71234797 |
| Molecular Formula | C20H25NS |
| Molecular Weight | 311.49 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 4,9-dimethyl-4,4a,5,6,7,7b,8,9,11a,12c-decahydro-3H-[1]benzothiolo[3,2-c]carbazole |
| SMILES | CC1C=CC2SC3=C(CCC4=C3C3C=CCC(C)C3N4)C2C1 |
| InChI | InChI=1S/C20H25NS/c1-11-6-9-17-15(10-11)13-7-8-16-18(20(13)22-17)14-5-3-4-12(2)19(14)21-16/h3,5-6,9,11-12,14-15,17,19,21H,4,7-8,10H2,1-2H3 |
| InChIKey | LDBRBSAOGMBBFJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|