C21H30S — CID 71234804
2,5a-dimethyl-2-(1-methylcyclohex-2-en-1-yl)-3,4,4a,6,7,9a-hexahydrodibenzothiophene (PubChem CID 71234804) has the molecular formula C21H30S and a molecular weight of 314.54 g/mol. Its IUPAC name is 2,5a-dimethyl-2-(1-methylcyclohex-2-en-1-yl)-3,4,4a,6,7,9a-hexahydrodibenzothiophene.
| Compound Name | 2,5a-dimethyl-2-(1-methylcyclohex-2-en-1-yl)-3,4,4a,6,7,9a-hexahydrodibenzothiophene |
|---|---|
| PubChem CID | 71234804 |
| Molecular Formula | C21H30S |
| Molecular Weight | 314.54 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 2,5a-dimethyl-2-(1-methylcyclohex-2-en-1-yl)-3,4,4a,6,7,9a-hexahydrodibenzothiophene |
| SMILES | CC12CCC=CC1C1=CC(C)(C3(C)C=CCCC3)CCC1S2 |
| InChI | InChI=1S/C21H30S/c1-19(11-6-4-7-12-19)20(2)14-10-18-16(15-20)17-9-5-8-13-21(17,3)22-18/h5-6,9,11,15,17-18H,4,7-8,10,12-14H2,1-3H3 |
| InChIKey | KVNYUMYLXOMCHW-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.54 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|