C19H25NO — CID 71234817
(5S)-2-[3-(6-aminocyclohexa-2,4-dien-1-yl)cyclohexa-1,3-dien-1-yl]-5-methylcyclohex-3-en-1-ol (PubChem CID 71234817) has the molecular formula C19H25NO and a molecular weight of 283.42 g/mol. Its IUPAC name is (5S)-2-[3-(6-aminocyclohexa-2,4-dien-1-yl)cyclohexa-1,3-dien-1-yl]-5-methylcyclohex-3-en-1-ol.
| Compound Name | (5S)-2-[3-(6-aminocyclohexa-2,4-dien-1-yl)cyclohexa-1,3-dien-1-yl]-5-methylcyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 71234817 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | (5S)-2-[3-(6-aminocyclohexa-2,4-dien-1-yl)cyclohexa-1,3-dien-1-yl]-5-methylcyclohex-3-en-1-ol |
| SMILES | C[C@@H]1C=CC(C2=CC(C3C=CC=CC3N)=CCC2)C(O)C1 |
| InChI | InChI=1S/C19H25NO/c1-13-9-10-17(19(21)11-13)15-6-4-5-14(12-15)16-7-2-3-8-18(16)20/h2-3,5,7-10,12-13,16-19,21H,4,6,11,20H2,1H3/t13-,16?,17?,18?,19?/m1/s1 |
| InChIKey | DYCLYASROQPITD-MHHRXVLKSA-N |
| XLogP | 3.28 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|