About 4-cyclohexa-1,3-dien-1-yl-3-methyl-2-(1-methylcyclohex-3-en-1-yl)cyclohexen-1-amine
4-cyclohexa-1,3-dien-1-yl-3-methyl-2-(1-methylcyclohex-3-en-1-yl)cyclohexen-1-amine (PubChem CID 71234821) has the molecular formula C20H29N
and a molecular weight of 283.46 g/mol. Its IUPAC name is 4-cyclohexa-1,3-dien-1-yl-3-methyl-2-(1-methylcyclohex-3-en-1-yl)cyclohexen-1-amine.
Molecular Properties
| Compound Name | 4-cyclohexa-1,3-dien-1-yl-3-methyl-2-(1-methylcyclohex-3-en-1-yl)cyclohexen-1-amine |
| PubChem CID | 71234821 |
| Molecular Formula | C20H29N |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | 4-cyclohexa-1,3-dien-1-yl-3-methyl-2-(1-methylcyclohex-3-en-1-yl)cyclohexen-1-amine |
| SMILES | CC1C(C2(C)CC=CCC2)=C(N)CCC1C1=CC=CCC1 |
| InChI | InChI=1S/C20H29N/c1-15-17(16-9-5-3-6-10-16)11-12-18(21)19(15)20(2)13-7-4-8-14-20/h3-5,7,9,15,17H,6,8,10-14,21H2,1-2H3 |
| InChIKey | FNVMENNZEQCNMX-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclohexa-1,3-dien-1-yl-3-methyl-2-(1-methylcyclohex-3-en-1-yl)cyclohexen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexa-1,3-dien-1-yl-3-methyl-2-(1-methylcyclohex-3-en-1-yl)cyclohexen-1-amine?
The IUPAC name of 4-cyclohexa-1,3-dien-1-yl-3-methyl-2-(1-methylcyclohex-3-en-1-yl)cyclohexen-1-amine (CID 71234821) is 4-cyclohexa-1,3-dien-1-yl-3-methyl-2-(1-methylcyclohex-3-en-1-yl)cyclohexen-1-amine.
What is the SMILES notation for 4-cyclohexa-1,3-dien-1-yl-3-methyl-2-(1-methylcyclohex-3-en-1-yl)cyclohexen-1-amine?
The canonical SMILES for 4-cyclohexa-1,3-dien-1-yl-3-methyl-2-(1-methylcyclohex-3-en-1-yl)cyclohexen-1-amine is CC1C(C2(C)CC=CCC2)=C(N)CCC1C1=CC=CCC1.
What is the InChIKey of 4-cyclohexa-1,3-dien-1-yl-3-methyl-2-(1-methylcyclohex-3-en-1-yl)cyclohexen-1-amine?
The InChIKey is FNVMENNZEQCNMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29N/c1-15-17(16-9-5-3-6-10-16)11-12-18(21)19(15)20(2)13-7-4-8-14-20/h3-5,7,9,15,17H,6,8,10-14,21H2,1-2H3.
What are the key properties of 4-cyclohexa-1,3-dien-1-yl-3-methyl-2-(1-methylcyclohex-3-en-1-yl)cyclohexen-1-amine?
4-cyclohexa-1,3-dien-1-yl-3-methyl-2-(1-methylcyclohex-3-en-1-yl)cyclohexen-1-amine has a molecular weight of 283.46 g/mol, XLogP of 5.27, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexa-1,3-dien-1-yl-3-methyl-2-(1-methylcyclohex-3-en-1-yl)cyclohexen-1-amine is sourced from PubChem (CID 71234821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).