C19H22S — CID 71234823
2-cyclohexa-2,4-dien-1-yl-3-methyl-2,3,4,4a,6,7-hexahydrodibenzothiophene (PubChem CID 71234823) has the molecular formula C19H22S and a molecular weight of 282.45 g/mol. Its IUPAC name is 2-cyclohexa-2,4-dien-1-yl-3-methyl-2,3,4,4a,6,7-hexahydrodibenzothiophene.
| Compound Name | 2-cyclohexa-2,4-dien-1-yl-3-methyl-2,3,4,4a,6,7-hexahydrodibenzothiophene |
|---|---|
| PubChem CID | 71234823 |
| Molecular Formula | C19H22S |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 2-cyclohexa-2,4-dien-1-yl-3-methyl-2,3,4,4a,6,7-hexahydrodibenzothiophene |
| SMILES | CC1CC2SC3=C(C=CCC3)C2=CC1C1C=CC=CC1 |
| InChI | InChI=1S/C19H22S/c1-13-11-19-17(15-9-5-6-10-18(15)20-19)12-16(13)14-7-3-2-4-8-14/h2-5,7,9,12-14,16,19H,6,8,10-11H2,1H3 |
| InChIKey | NLPHXJAXABWPKX-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |