C15H23N — CID 71234824
4,4a,5-trimethyl-1,2,3,4,5,6,9,9a-octahydrocarbazole (PubChem CID 71234824) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 4,4a,5-trimethyl-1,2,3,4,5,6,9,9a-octahydrocarbazole.
| Compound Name | 4,4a,5-trimethyl-1,2,3,4,5,6,9,9a-octahydrocarbazole |
|---|---|
| PubChem CID | 71234824 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 4,4a,5-trimethyl-1,2,3,4,5,6,9,9a-octahydrocarbazole |
| SMILES | CC1CC=CC2=C1C1(C)C(C)CCCC1N2 |
| InChI | InChI=1S/C15H23N/c1-10-6-4-8-12-14(10)15(3)11(2)7-5-9-13(15)16-12/h4,8,10-11,13,16H,5-7,9H2,1-3H3 |
| InChIKey | LUBQIPPPJHYZTF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |