C22H32N2 — CID 71234835
3-(3,4,4a,5,6,9a-hexahydrocarbazol-9-yl)-1-(1-methylcyclohex-2-en-1-yl)propan-1-amine (PubChem CID 71234835) has the molecular formula C22H32N2 and a molecular weight of 324.51 g/mol. Its IUPAC name is 3-(3,4,4a,5,6,9a-hexahydrocarbazol-9-yl)-1-(1-methylcyclohex-2-en-1-yl)propan-1-amine.
| Compound Name | 3-(3,4,4a,5,6,9a-hexahydrocarbazol-9-yl)-1-(1-methylcyclohex-2-en-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 71234835 |
| Molecular Formula | C22H32N2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | 3-(3,4,4a,5,6,9a-hexahydrocarbazol-9-yl)-1-(1-methylcyclohex-2-en-1-yl)propan-1-amine |
| SMILES | CC1(C(N)CCN2C3=C(CCC=C3)C3CCC=CC32)C=CCCC1 |
| InChI | InChI=1S/C22H32N2/c1-22(14-7-2-8-15-22)21(23)13-16-24-19-11-5-3-9-17(19)18-10-4-6-12-20(18)24/h5-7,11-12,14,17,19,21H,2-4,8-10,13,15-16,23H2,1H3 |
| InChIKey | ZDVCTBONBABHSW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|