C20H28N2 — CID 71234855
N'-[(4R)-2-cyclohexa-1,3-dien-1-yl-4-cyclohexa-1,5-dien-1-yl-4-methylcyclohexen-1-yl]methanediamine (PubChem CID 71234855) has the molecular formula C20H28N2 and a molecular weight of 296.46 g/mol. Its IUPAC name is N'-[(4R)-2-cyclohexa-1,3-dien-1-yl-4-cyclohexa-1,5-dien-1-yl-4-methylcyclohexen-1-yl]methanediamine.
| Compound Name | N'-[(4R)-2-cyclohexa-1,3-dien-1-yl-4-cyclohexa-1,5-dien-1-yl-4-methylcyclohexen-1-yl]methanediamine |
|---|---|
| PubChem CID | 71234855 |
| Molecular Formula | C20H28N2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | N'-[(4R)-2-cyclohexa-1,3-dien-1-yl-4-cyclohexa-1,5-dien-1-yl-4-methylcyclohexen-1-yl]methanediamine |
| SMILES | C[C@@]1(C2=CCCC=C2)CCC(NCN)=C(C2=CC=CCC2)C1 |
| InChI | InChI=1S/C20H28N2/c1-20(17-10-6-3-7-11-17)13-12-19(22-15-21)18(14-20)16-8-4-2-5-9-16/h2,4,6,8,10-11,22H,3,5,7,9,12-15,21H2,1H3/t20-/m1/s1 |
| InChIKey | BLMLXPWDXOHPQB-HXUWFJFHSA-N |
| XLogP | 4.49 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|