C22H33NS — CID 71234951
(9aS)-2,5a,7-trimethyl-2-(4-methylcyclohex-2-en-1-yl)-3,4,4a,6,7,9a-hexahydrodibenzothiophen-3-amine (PubChem CID 71234951) has the molecular formula C22H33NS and a molecular weight of 343.58 g/mol. Its IUPAC name is (9aS)-2,5a,7-trimethyl-2-(4-methylcyclohex-2-en-1-yl)-3,4,4a,6,7,9a-hexahydrodibenzothiophen-3-amine.
| Compound Name | (9aS)-2,5a,7-trimethyl-2-(4-methylcyclohex-2-en-1-yl)-3,4,4a,6,7,9a-hexahydrodibenzothiophen-3-amine |
|---|---|
| PubChem CID | 71234951 |
| Molecular Formula | C22H33NS |
| Molecular Weight | 343.58 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | (9aS)-2,5a,7-trimethyl-2-(4-methylcyclohex-2-en-1-yl)-3,4,4a,6,7,9a-hexahydrodibenzothiophen-3-amine |
| SMILES | CC1C=CC(C2(C)C=C3C(CC2N)SC2(C)CC(C)C=C[C@@H]32)CC1 |
| InChI | InChI=1S/C22H33NS/c1-14-5-8-16(9-6-14)21(3)13-17-18-10-7-15(2)12-22(18,4)24-19(17)11-20(21)23/h5,7-8,10,13-16,18-20H,6,9,11-12,23H2,1-4H3/t14?,15?,16?,18-,19?,20?,21?,22?/m0/s1 |
| InChIKey | BDXBFRQFPHYPNS-AWZBYOOUSA-N |
| XLogP | 5.34 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.58 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|