C18H13NO — CID 71234962
2,5-dihydro-1H-[1]benzofuro[3,2-c]carbazole (PubChem CID 71234962) has the molecular formula C18H13NO and a molecular weight of 259.31 g/mol. Its IUPAC name is 2,5-dihydro-1H-[1]benzofuro[3,2-c]carbazole.
| Compound Name | 2,5-dihydro-1H-[1]benzofuro[3,2-c]carbazole |
|---|---|
| PubChem CID | 71234962 |
| Molecular Formula | C18H13NO |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 2,5-dihydro-1H-[1]benzofuro[3,2-c]carbazole |
| SMILES | C1=Cc2[nH]c3ccc4c5ccccc5oc4c3c2CC1 |
| InChI | InChI=1S/C18H13NO/c1-3-7-14-13(6-1)17-15(19-14)10-9-12-11-5-2-4-8-16(11)20-18(12)17/h2-5,7-10,19H,1,6H2 |
| InChIKey | YAMPGGZZBKGDBL-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |