C21H23N — CID 71235163
9,9-dimethyl-1-phenyl-3,4,4b,8a-tetrahydrofluoren-2-amine (PubChem CID 71235163) has the molecular formula C21H23N and a molecular weight of 289.42 g/mol. Its IUPAC name is 9,9-dimethyl-1-phenyl-3,4,4b,8a-tetrahydrofluoren-2-amine.
| Compound Name | 9,9-dimethyl-1-phenyl-3,4,4b,8a-tetrahydrofluoren-2-amine |
|---|---|
| PubChem CID | 71235163 |
| Molecular Formula | C21H23N |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 9,9-dimethyl-1-phenyl-3,4,4b,8a-tetrahydrofluoren-2-amine |
| SMILES | CC1(C)C2=C(CCC(N)=C2c2ccccc2)C2C=CC=CC21 |
| InChI | InChI=1S/C21H23N/c1-21(2)17-11-7-6-10-15(17)16-12-13-18(22)19(20(16)21)14-8-4-3-5-9-14/h3-11,15,17H,12-13,22H2,1-2H3 |
| InChIKey | JYJFAPFXRQIXMP-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |