C25H34N2 — CID 71235167
1-(7a,11,12,12-tetramethyl-6,7,10,11,12a,12c-hexahydro-4aH-indeno[1,2-c]carbazol-5-yl)-N-methylmethanamine (PubChem CID 71235167) has the molecular formula C25H34N2 and a molecular weight of 362.56 g/mol. Its IUPAC name is 1-(7a,11,12,12-tetramethyl-6,7,10,11,12a,12c-hexahydro-4aH-indeno[1,2-c]carbazol-5-yl)-N-methylmethanamine.
| Compound Name | 1-(7a,11,12,12-tetramethyl-6,7,10,11,12a,12c-hexahydro-4aH-indeno[1,2-c]carbazol-5-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 71235167 |
| Molecular Formula | C25H34N2 |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | 1-(7a,11,12,12-tetramethyl-6,7,10,11,12a,12c-hexahydro-4aH-indeno[1,2-c]carbazol-5-yl)-N-methylmethanamine |
| SMILES | CNCN1C2=C(C3C=CC=CC31)C1C(C)(C)C3=C(C=CCC3C)C1(C)CC2 |
| InChI | InChI=1S/C25H34N2/c1-16-9-8-11-18-22(16)24(2,3)23-21-17-10-6-7-12-19(17)27(15-26-5)20(21)13-14-25(18,23)4/h6-8,10-12,16-17,19,23,26H,9,13-15H2,1-5H3 |
| InChIKey | SBBXTHJUNTVKKY-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |