C15H11F3N2O3S — CID 71235585
5-methyl-4-oxo-2-[(2,3,5-trifluorophenyl)methyl]-5,6-dihydro-3H-thieno[2,3-d]pyrimidine-6-carboxylic acid (PubChem CID 71235585) has the molecular formula C15H11F3N2O3S and a molecular weight of 356.33 g/mol. Its IUPAC name is 5-methyl-4-oxo-2-[(2,3,5-trifluorophenyl)methyl]-5,6-dihydro-3H-thieno[2,3-d]pyrimidine-6-carboxylic acid.
| Compound Name | 5-methyl-4-oxo-2-[(2,3,5-trifluorophenyl)methyl]-5,6-dihydro-3H-thieno[2,3-d]pyrimidine-6-carboxylic acid |
|---|---|
| PubChem CID | 71235585 |
| Molecular Formula | C15H11F3N2O3S |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | 5-methyl-4-oxo-2-[(2,3,5-trifluorophenyl)methyl]-5,6-dihydro-3H-thieno[2,3-d]pyrimidine-6-carboxylic acid |
| SMILES | CC1c2c(nc(Cc3cc(F)cc(F)c3F)[nH]c2=O)SC1C(=O)O |
| InChI | InChI=1S/C15H11F3N2O3S/c1-5-10-13(21)19-9(20-14(10)24-12(5)15(22)23)3-6-2-7(16)4-8(17)11(6)18/h2,4-5,12H,3H2,1H3,(H,22,23)(H,19,20,21) |
| InChIKey | IPMWWOWVLVMRRT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|