About 2-[(3S)-3,5-dimethylcyclohexen-1-yl]-3-methylcyclohexen-1-amine
2-[(3S)-3,5-dimethylcyclohexen-1-yl]-3-methylcyclohexen-1-amine (PubChem CID 71235714) has the molecular formula C15H25N
and a molecular weight of 219.37 g/mol. Its IUPAC name is 2-[(3S)-3,5-dimethylcyclohexen-1-yl]-3-methylcyclohexen-1-amine.
Molecular Properties
| Compound Name | 2-[(3S)-3,5-dimethylcyclohexen-1-yl]-3-methylcyclohexen-1-amine |
| PubChem CID | 71235714 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 2-[(3S)-3,5-dimethylcyclohexen-1-yl]-3-methylcyclohexen-1-amine |
| SMILES | CC1CC(C2=C(N)CCCC2C)=C[C@@H](C)C1 |
| InChI | InChI=1S/C15H25N/c1-10-7-11(2)9-13(8-10)15-12(3)5-4-6-14(15)16/h8,10-12H,4-7,9,16H2,1-3H3/t10-,11?,12?/m0/s1 |
| InChIKey | JRLRCDBUJQYKOI-UNXYVOJBSA-N |
| XLogP | 4.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(3S)-3,5-dimethylcyclohexen-1-yl]-3-methylcyclohexen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S)-3,5-dimethylcyclohexen-1-yl]-3-methylcyclohexen-1-amine?
The IUPAC name of 2-[(3S)-3,5-dimethylcyclohexen-1-yl]-3-methylcyclohexen-1-amine (CID 71235714) is 2-[(3S)-3,5-dimethylcyclohexen-1-yl]-3-methylcyclohexen-1-amine.
What is the SMILES notation for 2-[(3S)-3,5-dimethylcyclohexen-1-yl]-3-methylcyclohexen-1-amine?
The canonical SMILES for 2-[(3S)-3,5-dimethylcyclohexen-1-yl]-3-methylcyclohexen-1-amine is CC1CC(C2=C(N)CCCC2C)=C[C@@H](C)C1.
What is the InChIKey of 2-[(3S)-3,5-dimethylcyclohexen-1-yl]-3-methylcyclohexen-1-amine?
The InChIKey is JRLRCDBUJQYKOI-UNXYVOJBSA-N. The full InChI is InChI=1S/C15H25N/c1-10-7-11(2)9-13(8-10)15-12(3)5-4-6-14(15)16/h8,10-12H,4-7,9,16H2,1-3H3/t10-,11?,12?/m0/s1.
What are the key properties of 2-[(3S)-3,5-dimethylcyclohexen-1-yl]-3-methylcyclohexen-1-amine?
2-[(3S)-3,5-dimethylcyclohexen-1-yl]-3-methylcyclohexen-1-amine has a molecular weight of 219.37 g/mol, XLogP of 4.01, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S)-3,5-dimethylcyclohexen-1-yl]-3-methylcyclohexen-1-amine is sourced from PubChem (CID 71235714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).