C28H35N5O3 — CID 71235719
2-(1-methylindol-3-yl)-N-[(1R,2R)-2-[[1-(4-nitrophenyl)piperidin-3-yl]amino]cyclohexyl]acetamide (PubChem CID 71235719) has the molecular formula C28H35N5O3 and a molecular weight of 489.62 g/mol. Its IUPAC name is 2-(1-methylindol-3-yl)-N-[(1R,2R)-2-[[1-(4-nitrophenyl)piperidin-3-yl]amino]cyclohexyl]acetamide.
| Compound Name | 2-(1-methylindol-3-yl)-N-[(1R,2R)-2-[[1-(4-nitrophenyl)piperidin-3-yl]amino]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 71235719 |
| Molecular Formula | C28H35N5O3 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | 2-(1-methylindol-3-yl)-N-[(1R,2R)-2-[[1-(4-nitrophenyl)piperidin-3-yl]amino]cyclohexyl]acetamide |
| SMILES | Cn1cc(CC(=O)N[C@@H]2CCCC[C@H]2NC2CCCN(c3ccc([N+](=O)[O-])cc3)C2)c2ccccc21 |
| InChI | InChI=1S/C28H35N5O3/c1-31-18-20(24-8-2-5-11-27(24)31)17-28(34)30-26-10-4-3-9-25(26)29-21-7-6-16-32(19-21)22-12-14-23(15-13-22)33(35)36/h2,5,8,11-15,18,21,25-26,29H,3-4,6-7,9-10,16-17,19H2,1H3,(H,30,34)/t21?,25-,26-/m1/s1 |
| InChIKey | XMCWUQPPMBPZEU-JNVGEPLTSA-N |
| XLogP | 4.32 |
| TPSA | 92.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|