C22H34S — CID 71235760
(8S)-3,4a,8-trimethyl-8-(1-methylcyclohex-2-en-1-yl)-1,2,3,4,5a,6,7,9b-octahydrodibenzothiophene (PubChem CID 71235760) has the molecular formula C22H34S and a molecular weight of 330.58 g/mol. Its IUPAC name is (8S)-3,4a,8-trimethyl-8-(1-methylcyclohex-2-en-1-yl)-1,2,3,4,5a,6,7,9b-octahydrodibenzothiophene.
| Compound Name | (8S)-3,4a,8-trimethyl-8-(1-methylcyclohex-2-en-1-yl)-1,2,3,4,5a,6,7,9b-octahydrodibenzothiophene |
|---|---|
| PubChem CID | 71235760 |
| Molecular Formula | C22H34S |
| Molecular Weight | 330.58 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | (8S)-3,4a,8-trimethyl-8-(1-methylcyclohex-2-en-1-yl)-1,2,3,4,5a,6,7,9b-octahydrodibenzothiophene |
| SMILES | CC1CCC2C3=C[C@@](C)(C4(C)C=CCCC4)CCC3SC2(C)C1 |
| InChI | InChI=1S/C22H34S/c1-16-8-9-18-17-15-21(3,20(2)11-6-5-7-12-20)13-10-19(17)23-22(18,4)14-16/h6,11,15-16,18-19H,5,7-10,12-14H2,1-4H3/t16?,18?,19?,20?,21-,22?/m0/s1 |
| InChIKey | PMRLJOVRTYUBNZ-IIKOFUJUSA-N |
| XLogP | 6.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.58 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|