C22H37NO — CID 71235763
2-[4-amino-3-methyl-3-(1-methylcyclohex-3-en-1-yl)cyclohexyl]-3,5-dimethylcyclohexen-1-ol (PubChem CID 71235763) has the molecular formula C22H37NO and a molecular weight of 331.54 g/mol. Its IUPAC name is 2-[4-amino-3-methyl-3-(1-methylcyclohex-3-en-1-yl)cyclohexyl]-3,5-dimethylcyclohexen-1-ol.
| Compound Name | 2-[4-amino-3-methyl-3-(1-methylcyclohex-3-en-1-yl)cyclohexyl]-3,5-dimethylcyclohexen-1-ol |
|---|---|
| PubChem CID | 71235763 |
| Molecular Formula | C22H37NO |
| Molecular Weight | 331.54 g/mol |
| Exact Mass | 331.29 |
| IUPAC Name | 2-[4-amino-3-methyl-3-(1-methylcyclohex-3-en-1-yl)cyclohexyl]-3,5-dimethylcyclohexen-1-ol |
| SMILES | CC1CC(O)=C(C2CCC(N)C(C)(C3(C)CC=CCC3)C2)C(C)C1 |
| InChI | InChI=1S/C22H37NO/c1-15-12-16(2)20(18(24)13-15)17-8-9-19(23)22(4,14-17)21(3)10-6-5-7-11-21/h5-6,15-17,19,24H,7-14,23H2,1-4H3 |
| InChIKey | CUVSXIBTQWDJTN-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.54 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|