C13H21N3O6 — CID 71236049
N-[(3R,4R)-6-aminooxy-3,4-dihydroxyhexyl]-3-(2,5-dioxopyrrol-1-yl)propanamide (PubChem CID 71236049) has the molecular formula C13H21N3O6 and a molecular weight of 315.33 g/mol. Its IUPAC name is N-[(3R,4R)-6-aminooxy-3,4-dihydroxyhexyl]-3-(2,5-dioxopyrrol-1-yl)propanamide.
| Compound Name | N-[(3R,4R)-6-aminooxy-3,4-dihydroxyhexyl]-3-(2,5-dioxopyrrol-1-yl)propanamide |
|---|---|
| PubChem CID | 71236049 |
| Molecular Formula | C13H21N3O6 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | N-[(3R,4R)-6-aminooxy-3,4-dihydroxyhexyl]-3-(2,5-dioxopyrrol-1-yl)propanamide |
| SMILES | NOCC[C@@H](O)[C@H](O)CCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C13H21N3O6/c14-22-8-5-10(18)9(17)3-6-15-11(19)4-7-16-12(20)1-2-13(16)21/h1-2,9-10,17-18H,3-8,14H2,(H,15,19)/t9-,10-/m1/s1 |
| InChIKey | MQPZXJRMKBUYIV-NXEZZACHSA-N |
| XLogP | -2.19 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|