C15H27NO3 — CID 71236086
(7E,9S,10S,11R,12Z)-9-methoxy-11,13-dimethyl-1-oxa-4-azacyclotetradeca-7,12-dien-10-ol (PubChem CID 71236086) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is (7E,9S,10S,11R,12Z)-9-methoxy-11,13-dimethyl-1-oxa-4-azacyclotetradeca-7,12-dien-10-ol.
| Compound Name | (7E,9S,10S,11R,12Z)-9-methoxy-11,13-dimethyl-1-oxa-4-azacyclotetradeca-7,12-dien-10-ol |
|---|---|
| PubChem CID | 71236086 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | (7E,9S,10S,11R,12Z)-9-methoxy-11,13-dimethyl-1-oxa-4-azacyclotetradeca-7,12-dien-10-ol |
| SMILES | CO[C@H]1/C=C/CCNCCOC/C(C)=C\[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C15H27NO3/c1-12-10-13(2)15(17)14(18-3)6-4-5-7-16-8-9-19-11-12/h4,6,10,13-17H,5,7-9,11H2,1-3H3/b6-4+,12-10-/t13-,14+,15+/m1/s1 |
| InChIKey | BHHNBCJLSNHJQI-XNOWFPNMSA-N |
| XLogP | 1.51 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|