C15H25NO3 — CID 71236094
(6E,8S,9S,10R,11Z)-9-hydroxy-8-methoxy-10,12-dimethyl-1-azacyclotrideca-6,11-dien-2-one (PubChem CID 71236094) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is (6E,8S,9S,10R,11Z)-9-hydroxy-8-methoxy-10,12-dimethyl-1-azacyclotrideca-6,11-dien-2-one.
| Compound Name | (6E,8S,9S,10R,11Z)-9-hydroxy-8-methoxy-10,12-dimethyl-1-azacyclotrideca-6,11-dien-2-one |
|---|---|
| PubChem CID | 71236094 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | (6E,8S,9S,10R,11Z)-9-hydroxy-8-methoxy-10,12-dimethyl-1-azacyclotrideca-6,11-dien-2-one |
| SMILES | CO[C@H]1/C=C/CCCC(=O)NC/C(C)=C\[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C15H25NO3/c1-11-9-12(2)15(18)13(19-3)7-5-4-6-8-14(17)16-10-11/h5,7,9,12-13,15,18H,4,6,8,10H2,1-3H3,(H,16,17)/b7-5+,11-9-/t12-,13+,15+/m1/s1 |
| InChIKey | RBRZWZLHWWRTSF-UJGRFKBTSA-N |
| XLogP | 1.80 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|