C16H29NO3 — CID 71236102
(7E,9S,10S,11R,12Z)-9-methoxy-5,11,13-trimethyl-1-oxa-5-azacyclotetradeca-7,12-dien-10-ol (PubChem CID 71236102) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is (7E,9S,10S,11R,12Z)-9-methoxy-5,11,13-trimethyl-1-oxa-5-azacyclotetradeca-7,12-dien-10-ol.
| Compound Name | (7E,9S,10S,11R,12Z)-9-methoxy-5,11,13-trimethyl-1-oxa-5-azacyclotetradeca-7,12-dien-10-ol |
|---|---|
| PubChem CID | 71236102 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | (7E,9S,10S,11R,12Z)-9-methoxy-5,11,13-trimethyl-1-oxa-5-azacyclotetradeca-7,12-dien-10-ol |
| SMILES | CO[C@H]1/C=C/CN(C)CCCOC/C(C)=C\[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C16H29NO3/c1-13-11-14(2)16(18)15(19-4)7-5-8-17(3)9-6-10-20-12-13/h5,7,11,14-16,18H,6,8-10,12H2,1-4H3/b7-5+,13-11-/t14-,15+,16+/m1/s1 |
| InChIKey | HHNULQKSYPCWAV-JIPROSIPSA-N |
| XLogP | 1.85 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|