C17H31NO2 — CID 71236104
(3Z,5R,6S,7S,8E)-1-ethyl-3,5-dimethyl-1-azacyclotetradeca-3,8-diene-6,7-diol (PubChem CID 71236104) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is (3Z,5R,6S,7S,8E)-1-ethyl-3,5-dimethyl-1-azacyclotetradeca-3,8-diene-6,7-diol.
| Compound Name | (3Z,5R,6S,7S,8E)-1-ethyl-3,5-dimethyl-1-azacyclotetradeca-3,8-diene-6,7-diol |
|---|---|
| PubChem CID | 71236104 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | (3Z,5R,6S,7S,8E)-1-ethyl-3,5-dimethyl-1-azacyclotetradeca-3,8-diene-6,7-diol |
| SMILES | CCN1CCCCC/C=C/[C@H](O)[C@@H](O)[C@H](C)/C=C(/C)C1 |
| InChI | InChI=1S/C17H31NO2/c1-4-18-11-9-7-5-6-8-10-16(19)17(20)15(3)12-14(2)13-18/h8,10,12,15-17,19-20H,4-7,9,11,13H2,1-3H3/b10-8+,14-12-/t15-,16+,17+/m1/s1 |
| InChIKey | OVVRFMSGVDQTOM-ZFJCARCOSA-N |
| XLogP | 2.74 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|