C14H22N2O3 — CID 71236105
(7E,9S,10S,11R)-10-hydroxy-9-methoxy-13-methyl-1,3-diazabicyclo[9.3.0]tetradeca-7,12-dien-2-one (PubChem CID 71236105) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is (7E,9S,10S,11R)-10-hydroxy-9-methoxy-13-methyl-1,3-diazabicyclo[9.3.0]tetradeca-7,12-dien-2-one.
| Compound Name | (7E,9S,10S,11R)-10-hydroxy-9-methoxy-13-methyl-1,3-diazabicyclo[9.3.0]tetradeca-7,12-dien-2-one |
|---|---|
| PubChem CID | 71236105 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | (7E,9S,10S,11R)-10-hydroxy-9-methoxy-13-methyl-1,3-diazabicyclo[9.3.0]tetradeca-7,12-dien-2-one |
| SMILES | CO[C@H]1/C=C/CCCNC(=O)N2CC(C)=C[C@@H]2[C@@H]1O |
| InChI | InChI=1S/C14H22N2O3/c1-10-8-11-13(17)12(19-2)6-4-3-5-7-15-14(18)16(11)9-10/h4,6,8,11-13,17H,3,5,7,9H2,1-2H3,(H,15,18)/b6-4+/t11-,12+,13+/m1/s1 |
| InChIKey | RCWPDFFHBWALPN-IEZGYGFOSA-N |
| XLogP | 1.05 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|