C17H31NO2 — CID 71236125
(3Z,5R,6S,7S,8E)-7-methoxy-1,3,5-trimethyl-1-azacyclotetradeca-3,8-dien-6-ol (PubChem CID 71236125) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is (3Z,5R,6S,7S,8E)-7-methoxy-1,3,5-trimethyl-1-azacyclotetradeca-3,8-dien-6-ol.
| Compound Name | (3Z,5R,6S,7S,8E)-7-methoxy-1,3,5-trimethyl-1-azacyclotetradeca-3,8-dien-6-ol |
|---|---|
| PubChem CID | 71236125 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | (3Z,5R,6S,7S,8E)-7-methoxy-1,3,5-trimethyl-1-azacyclotetradeca-3,8-dien-6-ol |
| SMILES | CO[C@H]1/C=C/CCCCCN(C)C/C(C)=C\[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C17H31NO2/c1-14-12-15(2)17(19)16(20-4)10-8-6-5-7-9-11-18(3)13-14/h8,10,12,15-17,19H,5-7,9,11,13H2,1-4H3/b10-8+,14-12-/t15-,16+,17+/m1/s1 |
| InChIKey | RHZVDWVURCGKLO-ZFJCARCOSA-N |
| XLogP | 3.01 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|