C21H40O4Si — CID 71236126
tert-butyl-[[(7Z,9R,10S,11S,12E)-11-methoxy-7,9-dimethyl-1,5-dioxacyclotetradeca-7,12-dien-10-yl]oxy]-dimethylsilane (PubChem CID 71236126) has the molecular formula C21H40O4Si and a molecular weight of 384.63 g/mol. Its IUPAC name is tert-butyl-[[(7Z,9R,10S,11S,12E)-11-methoxy-7,9-dimethyl-1,5-dioxacyclotetradeca-7,12-dien-10-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(7Z,9R,10S,11S,12E)-11-methoxy-7,9-dimethyl-1,5-dioxacyclotetradeca-7,12-dien-10-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 71236126 |
| Molecular Formula | C21H40O4Si |
| Molecular Weight | 384.63 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | tert-butyl-[[(7Z,9R,10S,11S,12E)-11-methoxy-7,9-dimethyl-1,5-dioxacyclotetradeca-7,12-dien-10-yl]oxy]-dimethylsilane |
| SMILES | CO[C@H]1/C=C/COCCCOC/C(C)=C\[C@@H](C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H40O4Si/c1-17-15-18(2)20(25-26(7,8)21(3,4)5)19(22-6)11-9-12-23-13-10-14-24-16-17/h9,11,15,18-20H,10,12-14,16H2,1-8H3/b11-9+,17-15-/t18-,19+,20+/m1/s1 |
| InChIKey | MCZSUIJLYUIEGK-AXFCYUAVSA-N |
| XLogP | 4.97 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.63 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|