C23H43NO3Si — CID 71236131
(7E,9S,10S,11R,12Z)-10-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-1,11,13-trimethyl-1-azacyclotetradeca-7,12-dien-2-one (PubChem CID 71236131) has the molecular formula C23H43NO3Si and a molecular weight of 409.69 g/mol. Its IUPAC name is (7E,9S,10S,11R,12Z)-10-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-1,11,13-trimethyl-1-azacyclotetradeca-7,12-dien-2-one.
| Compound Name | (7E,9S,10S,11R,12Z)-10-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-1,11,13-trimethyl-1-azacyclotetradeca-7,12-dien-2-one |
|---|---|
| PubChem CID | 71236131 |
| Molecular Formula | C23H43NO3Si |
| Molecular Weight | 409.69 g/mol |
| Exact Mass | 409.30 |
| IUPAC Name | (7E,9S,10S,11R,12Z)-10-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-1,11,13-trimethyl-1-azacyclotetradeca-7,12-dien-2-one |
| SMILES | CO[C@H]1/C=C/CCCCC(=O)N(C)C/C(C)=C\[C@@H](C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H43NO3Si/c1-18-16-19(2)22(27-28(8,9)23(3,4)5)20(26-7)14-12-10-11-13-15-21(25)24(6)17-18/h12,14,16,19-20,22H,10-11,13,15,17H2,1-9H3/b14-12+,18-16-/t19-,20+,22+/m1/s1 |
| InChIKey | SGLUNKYDOVDXNC-ITWACJLPSA-N |
| XLogP | 5.56 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.69 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|