C24H45NO3Si — CID 71236132
(7E,9S,10S,11R,12Z)-10-[tert-butyl(dimethyl)silyl]oxy-1-ethyl-9-methoxy-11,13-dimethyl-1-azacyclotetradeca-7,12-dien-2-one (PubChem CID 71236132) has the molecular formula C24H45NO3Si and a molecular weight of 423.71 g/mol. Its IUPAC name is (7E,9S,10S,11R,12Z)-10-[tert-butyl(dimethyl)silyl]oxy-1-ethyl-9-methoxy-11,13-dimethyl-1-azacyclotetradeca-7,12-dien-2-one.
| Compound Name | (7E,9S,10S,11R,12Z)-10-[tert-butyl(dimethyl)silyl]oxy-1-ethyl-9-methoxy-11,13-dimethyl-1-azacyclotetradeca-7,12-dien-2-one |
|---|---|
| PubChem CID | 71236132 |
| Molecular Formula | C24H45NO3Si |
| Molecular Weight | 423.71 g/mol |
| Exact Mass | 423.32 |
| IUPAC Name | (7E,9S,10S,11R,12Z)-10-[tert-butyl(dimethyl)silyl]oxy-1-ethyl-9-methoxy-11,13-dimethyl-1-azacyclotetradeca-7,12-dien-2-one |
| SMILES | CCN1C/C(C)=C\[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](OC)/C=C/CCCCC1=O |
| InChI | InChI=1S/C24H45NO3Si/c1-10-25-18-19(2)17-20(3)23(28-29(8,9)24(4,5)6)21(27-7)15-13-11-12-14-16-22(25)26/h13,15,17,20-21,23H,10-12,14,16,18H2,1-9H3/b15-13+,19-17-/t20-,21+,23+/m1/s1 |
| InChIKey | HXSVPPPZOHXUNB-VDVLVKFKSA-N |
| XLogP | 5.95 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.71 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|