C12H19N3O2 — CID 71236309
4-[(3S)-3-cyanopiperidin-1-yl]-2,2-dimethyl-4-oxobutanamide (PubChem CID 71236309) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is 4-[(3S)-3-cyanopiperidin-1-yl]-2,2-dimethyl-4-oxobutanamide.
| Compound Name | 4-[(3S)-3-cyanopiperidin-1-yl]-2,2-dimethyl-4-oxobutanamide |
|---|---|
| PubChem CID | 71236309 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 4-[(3S)-3-cyanopiperidin-1-yl]-2,2-dimethyl-4-oxobutanamide |
| SMILES | CC(C)(CC(=O)N1CCC[C@H](C#N)C1)C(N)=O |
| InChI | InChI=1S/C12H19N3O2/c1-12(2,11(14)17)6-10(16)15-5-3-4-9(7-13)8-15/h9H,3-6,8H2,1-2H3,(H2,14,17)/t9-/m1/s1 |
| InChIKey | IZFHGZVUMIZDHR-SECBINFHSA-N |
| XLogP | 0.65 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |