About 3-phenyl-1,2,4-triazine
3-phenyl-1,2,4-triazine (PubChem CID 71236553) has the molecular formula C18H14N6
and a molecular weight of 314.35 g/mol. Its IUPAC name is 3-phenyl-1,2,4-triazine.
Molecular Properties
| Compound Name | 3-phenyl-1,2,4-triazine |
| PubChem CID | 71236553 |
| Molecular Formula | C18H14N6 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 3-phenyl-1,2,4-triazine |
| SMILES | c1ccc(-c2nccnn2)cc1.c1ccc(-c2nccnn2)cc1 |
| InChI | InChI=1S/2C9H7N3/c2*1-2-4-8(5-3-1)9-10-6-7-11-12-9/h2*1-7H |
| InChIKey | GIYPQGPYTXSFSG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-phenyl-1,2,4-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-1,2,4-triazine?
The IUPAC name of 3-phenyl-1,2,4-triazine (CID 71236553) is 3-phenyl-1,2,4-triazine.
What is the SMILES notation for 3-phenyl-1,2,4-triazine?
The canonical SMILES for 3-phenyl-1,2,4-triazine is c1ccc(-c2nccnn2)cc1.c1ccc(-c2nccnn2)cc1.
What is the InChIKey of 3-phenyl-1,2,4-triazine?
The InChIKey is GIYPQGPYTXSFSG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H7N3/c2*1-2-4-8(5-3-1)9-10-6-7-11-12-9/h2*1-7H.
What are the key properties of 3-phenyl-1,2,4-triazine?
3-phenyl-1,2,4-triazine has a molecular weight of 314.35 g/mol, XLogP of 3.08, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-1,2,4-triazine is sourced from PubChem (CID 71236553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).