C23H21ClF3N5O2 — CID 71237046
[1-[2-(3-amino-7-chloro-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-15-yl)ethyl]triazol-4-yl]methyl 2,2,2-trifluoroacetate (PubChem CID 71237046) has the molecular formula C23H21ClF3N5O2 and a molecular weight of 491.90 g/mol. Its IUPAC name is [1-[2-(3-amino-7-chloro-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-15-yl)ethyl]triazol-4-yl]methyl 2,2,2-trifluoroacetate.
| Compound Name | [1-[2-(3-amino-7-chloro-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-15-yl)ethyl]triazol-4-yl]methyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 71237046 |
| Molecular Formula | C23H21ClF3N5O2 |
| Molecular Weight | 491.90 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | [1-[2-(3-amino-7-chloro-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-15-yl)ethyl]triazol-4-yl]methyl 2,2,2-trifluoroacetate |
| SMILES | Nc1c2c(nc3cc(Cl)ccc13)CC1C=C(CCn3cc(COC(=O)C(F)(F)F)nn3)CC2C1 |
| InChI | InChI=1S/C23H21ClF3N5O2/c24-15-1-2-17-18(9-15)29-19-8-13-5-12(6-14(7-13)20(19)21(17)28)3-4-32-10-16(30-31-32)11-34-22(33)23(25,26)27/h1-2,5,9-10,13-14H,3-4,6-8,11H2,(H2,28,29) |
| InChIKey | HWVILTMRFYCEMG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.90 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|