C27H36N2O7S — CID 71237740
(2R)-2-[[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]methylamino]butanedioic acid (PubChem CID 71237740) has the molecular formula C27H36N2O7S and a molecular weight of 532.66 g/mol. Its IUPAC name is (2R)-2-[[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]methylamino]butanedioic acid.
| Compound Name | (2R)-2-[[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]methylamino]butanedioic acid |
|---|---|
| PubChem CID | 71237740 |
| Molecular Formula | C27H36N2O7S |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | (2R)-2-[[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]methylamino]butanedioic acid |
| SMILES | CCCC[C@]1(CC)CS(=O)(=O)c2cc(CN[C@H](CC(=O)O)C(=O)O)c(OC)cc2[C@@H](c2ccccc2)N1 |
| InChI | InChI=1S/C27H36N2O7S/c1-4-6-12-27(5-2)17-37(34,35)23-13-19(16-28-21(26(32)33)15-24(30)31)22(36-3)14-20(23)25(29-27)18-10-8-7-9-11-18/h7-11,13-14,21,25,28-29H,4-6,12,15-17H2,1-3H3,(H,30,31)(H,32,33)/t21-,25-,27-/m1/s1 |
| InChIKey | XMAQTKVJNKAOMZ-FZBZCGEPSA-N |
| XLogP | 3.52 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |