About (3R,4R)-1-tert-butyl-3-(4-fluorophenyl)piperidine-4-carboxylic acid;hydrochloride
(3R,4R)-1-tert-butyl-3-(4-fluorophenyl)piperidine-4-carboxylic acid;hydrochloride (PubChem CID 71237779) has the molecular formula C16H23ClFNO2
and a molecular weight of 315.82 g/mol. Its IUPAC name is (3R,4R)-1-tert-butyl-3-(4-fluorophenyl)piperidine-4-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | (3R,4R)-1-tert-butyl-3-(4-fluorophenyl)piperidine-4-carboxylic acid;hydrochloride |
| PubChem CID | 71237779 |
| Molecular Formula | C16H23ClFNO2 |
| Molecular Weight | 315.82 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | (3R,4R)-1-tert-butyl-3-(4-fluorophenyl)piperidine-4-carboxylic acid;hydrochloride |
| SMILES | CC(C)(C)N1CC[C@@H](C(=O)O)[C@H](c2ccc(F)cc2)C1.Cl |
| InChI | InChI=1S/C16H22FNO2.ClH/c1-16(2,3)18-9-8-13(15(19)20)14(10-18)11-4-6-12(17)7-5-11;/h4-7,13-14H,8-10H2,1-3H3,(H,19,20);1H/t13-,14+;/m1./s1 |
| InChIKey | DBFJHSCCHCIUMY-DFQHDRSWSA-N |
| XLogP | 3.54 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.82 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R,4R)-1-tert-butyl-3-(4-fluorophenyl)piperidine-4-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-1-tert-butyl-3-(4-fluorophenyl)piperidine-4-carboxylic acid;hydrochloride?
The IUPAC name of (3R,4R)-1-tert-butyl-3-(4-fluorophenyl)piperidine-4-carboxylic acid;hydrochloride (CID 71237779) is (3R,4R)-1-tert-butyl-3-(4-fluorophenyl)piperidine-4-carboxylic acid;hydrochloride.
What is the SMILES notation for (3R,4R)-1-tert-butyl-3-(4-fluorophenyl)piperidine-4-carboxylic acid;hydrochloride?
The canonical SMILES for (3R,4R)-1-tert-butyl-3-(4-fluorophenyl)piperidine-4-carboxylic acid;hydrochloride is CC(C)(C)N1CC[C@@H](C(=O)O)[C@H](c2ccc(F)cc2)C1.Cl.
What is the InChIKey of (3R,4R)-1-tert-butyl-3-(4-fluorophenyl)piperidine-4-carboxylic acid;hydrochloride?
The InChIKey is DBFJHSCCHCIUMY-DFQHDRSWSA-N. The full InChI is InChI=1S/C16H22FNO2.ClH/c1-16(2,3)18-9-8-13(15(19)20)14(10-18)11-4-6-12(17)7-5-11;/h4-7,13-14H,8-10H2,1-3H3,(H,19,20);1H/t13-,14+;/m1./s1.
What are the key properties of (3R,4R)-1-tert-butyl-3-(4-fluorophenyl)piperidine-4-carboxylic acid;hydrochloride?
(3R,4R)-1-tert-butyl-3-(4-fluorophenyl)piperidine-4-carboxylic acid;hydrochloride has a molecular weight of 315.82 g/mol, XLogP of 3.54, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-1-tert-butyl-3-(4-fluorophenyl)piperidine-4-carboxylic acid;hydrochloride is sourced from PubChem (CID 71237779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).