C21H27BN2O4 — CID 71238419
(4R)-4-[(1R)-1-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-5-yl]oxyethyl]pyrrolidin-2-one (PubChem CID 71238419) has the molecular formula C21H27BN2O4 and a molecular weight of 382.27 g/mol. Its IUPAC name is (4R)-4-[(1R)-1-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-5-yl]oxyethyl]pyrrolidin-2-one.
| Compound Name | (4R)-4-[(1R)-1-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-5-yl]oxyethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 71238419 |
| Molecular Formula | C21H27BN2O4 |
| Molecular Weight | 382.27 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | (4R)-4-[(1R)-1-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-5-yl]oxyethyl]pyrrolidin-2-one |
| SMILES | C[C@@H](Oc1cc(B2OC(C)(C)C(C)(C)O2)cc2ncccc12)[C@H]1CNC(=O)C1 |
| InChI | InChI=1S/C21H27BN2O4/c1-13(14-9-19(25)24-12-14)26-18-11-15(10-17-16(18)7-6-8-23-17)22-27-20(2,3)21(4,5)28-22/h6-8,10-11,13-14H,9,12H2,1-5H3,(H,24,25)/t13-,14-/m1/s1 |
| InChIKey | PLKJAMISFHGIIQ-ZIAGYGMSSA-N |
| XLogP | 2.44 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.27 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|