C11H9F3N4O — CID 71238623
6-phenyl-5-(1,1,2-trifluoroethoxy)-1,2,4-triazin-3-amine (PubChem CID 71238623) has the molecular formula C11H9F3N4O and a molecular weight of 270.21 g/mol. Its IUPAC name is 6-phenyl-5-(1,1,2-trifluoroethoxy)-1,2,4-triazin-3-amine.
| Compound Name | 6-phenyl-5-(1,1,2-trifluoroethoxy)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 71238623 |
| Molecular Formula | C11H9F3N4O |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 6-phenyl-5-(1,1,2-trifluoroethoxy)-1,2,4-triazin-3-amine |
| SMILES | Nc1nnc(-c2ccccc2)c(OC(F)(F)CF)n1 |
| InChI | InChI=1S/C11H9F3N4O/c12-6-11(13,14)19-9-8(17-18-10(15)16-9)7-4-2-1-3-5-7/h1-5H,6H2,(H2,15,16,18) |
| InChIKey | OIWXBPPZKHVOEV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |